C26H33N3O7 — CID 24517051
1-butyl-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 24517051) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is 1-butyl-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-butyl-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 24517051 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 1-butyl-N-[2-(4,5-dimethoxy-2-nitrophenyl)ethyl]-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CC(C(=O)NCCc2cc(OC)c(OC)cc2[N+](=O)[O-])C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H33N3O7/c1-5-6-13-28-24(30)15-20(25(28)17-7-9-19(34-2)10-8-17)26(31)27-12-11-18-14-22(35-3)23(36-4)16-21(18)29(32)33/h7-10,14,16,20,25H,5-6,11-13,15H2,1-4H3,(H,27,31) |
| InChIKey | LIXSIEJRQJSNAR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|