About N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide
N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide (PubChem CID 2451997) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide |
| PubChem CID | 2451997 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3cn[nH]c3c2)c(OC)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-21-12-5-6-13(15(8-12)22-2)16(20)18-11-4-3-10-9-17-19-14(10)7-11/h3-9H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ZDSHDKPKSKTZRB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide?
The IUPAC name of N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide (CID 2451997) is N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide.
What is the SMILES notation for N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide?
The canonical SMILES for N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide is COc1ccc(C(=O)Nc2ccc3cn[nH]c3c2)c(OC)c1.
What is the InChIKey of N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide?
The InChIKey is ZDSHDKPKSKTZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-21-12-5-6-13(15(8-12)22-2)16(20)18-11-4-3-10-9-17-19-14(10)7-11/h3-9H,1-2H3,(H,17,19)(H,18,20).
What are the key properties of N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide?
N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide has a molecular weight of 297.31 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-6-yl)-2,4-dimethoxybenzamide is sourced from PubChem (CID 2451997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).