About [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate
[4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate (PubChem CID 24521652) has the molecular formula C20H12F3N3O2S
and a molecular weight of 415.40 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
| PubChem CID | 24521652 |
| Molecular Formula | C20H12F3N3O2S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
| SMILES | O=C(OCc1ccc(C(F)(F)F)cc1)c1nccnc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12F3N3O2S/c21-20(22,23)13-7-5-12(6-8-13)11-28-19(27)17-16(24-9-10-25-17)18-26-14-3-1-2-4-15(14)29-18/h1-10H,11H2 |
| InChIKey | URBRGRNISXJRBB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The IUPAC name of [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate (CID 24521652) is [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The canonical SMILES for [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate is O=C(OCc1ccc(C(F)(F)F)cc1)c1nccnc1-c1nc2ccccc2s1.
What is the InChIKey of [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The InChIKey is URBRGRNISXJRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F3N3O2S/c21-20(22,23)13-7-5-12(6-8-13)11-28-19(27)17-16(24-9-10-25-17)18-26-14-3-1-2-4-15(14)29-18/h1-10H,11H2.
What are the key properties of [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
[4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate has a molecular weight of 415.40 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl]methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 24521652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).