About ethyl 3-hydroxybenzoate
ethyl 3-hydroxybenzoate (PubChem CID 24522) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is ethyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | ethyl 3-hydroxybenzoate |
| PubChem CID | 24522 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | ethyl 3-hydroxybenzoate |
| SMILES | CCOC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6,10H,2H2,1H3 |
| InChIKey | MWSMNBYIEBRXAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxybenzoate?
The IUPAC name of ethyl 3-hydroxybenzoate (CID 24522) is ethyl 3-hydroxybenzoate.
What is the SMILES notation for ethyl 3-hydroxybenzoate?
The canonical SMILES for ethyl 3-hydroxybenzoate is CCOC(=O)c1cccc(O)c1.
What is the InChIKey of ethyl 3-hydroxybenzoate?
The InChIKey is MWSMNBYIEBRXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6,10H,2H2,1H3.
What are the key properties of ethyl 3-hydroxybenzoate?
ethyl 3-hydroxybenzoate has a molecular weight of 166.18 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxybenzoate is sourced from PubChem (CID 24522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).