C20H20N4O3S — CID 24523050
N-[(2,3-dimethylphenyl)carbamoyl]-2-(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)acetamide (PubChem CID 24523050) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)carbamoyl]-2-(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)acetamide.
| Compound Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)acetamide |
|---|---|
| PubChem CID | 24523050 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[(2,3-dimethylphenyl)carbamoyl]-2-(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)NC(=O)Cn2cnc3sc4c(c3c2=O)CCC4)c1C |
| InChI | InChI=1S/C20H20N4O3S/c1-11-5-3-7-14(12(11)2)22-20(27)23-16(25)9-24-10-21-18-17(19(24)26)13-6-4-8-15(13)28-18/h3,5,7,10H,4,6,8-9H2,1-2H3,(H2,22,23,25,27) |
| InChIKey | RWBWBWQUXIXBON-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |