C13H16N6O3S2 — CID 24523077
2-[[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 24523077) has the molecular formula C13H16N6O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24523077 |
| Molecular Formula | C13H16N6O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CSc1nnnn1CC1CCCO1 |
| InChI | InChI=1S/C13H16N6O3S2/c14-11(21)9-3-5-23-12(9)15-10(20)7-24-13-16-17-18-19(13)6-8-2-1-4-22-8/h3,5,8H,1-2,4,6-7H2,(H2,14,21)(H,15,20) |
| InChIKey | COIFHNITESZDRS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |