C19H25NO3 — CID 24525991
2-(2-formylphenoxy)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 24525991) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(2-formylphenoxy)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | 2-(2-formylphenoxy)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 24525991 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(2-formylphenoxy)-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)COc1ccccc1C=O)C2 |
| InChI | InChI=1S/C19H25NO3/c1-18(2)14-8-9-19(18,3)16(10-14)20-17(22)12-23-15-7-5-4-6-13(15)11-21/h4-7,11,14,16H,8-10,12H2,1-3H3,(H,20,22) |
| InChIKey | JWNFJKMHUHQNKQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|