About N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide
N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide (PubChem CID 24527618) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide |
| PubChem CID | 24527618 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide |
| SMILES | Cc1cc(C)c(SCC(=O)NCCC#N)c(C)c1 |
| InChI | InChI=1S/C14H18N2OS/c1-10-7-11(2)14(12(3)8-10)18-9-13(17)16-6-4-5-15/h7-8H,4,6,9H2,1-3H3,(H,16,17) |
| InChIKey | AJLVDQLARCRPJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide?
The IUPAC name of N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide (CID 24527618) is N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide.
What is the SMILES notation for N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide?
The canonical SMILES for N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide is Cc1cc(C)c(SCC(=O)NCCC#N)c(C)c1.
What is the InChIKey of N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide?
The InChIKey is AJLVDQLARCRPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-10-7-11(2)14(12(3)8-10)18-9-13(17)16-6-4-5-15/h7-8H,4,6,9H2,1-3H3,(H,16,17).
What are the key properties of N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide?
N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide has a molecular weight of 262.38 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-2-(2,4,6-trimethylphenyl)sulfanylacetamide is sourced from PubChem (CID 24527618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).