C25H22N2O3S3 — CID 24529548
[4-(1,3-dithiolan-2-yl)phenyl] 3-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate (PubChem CID 24529548) has the molecular formula C25H22N2O3S3 and a molecular weight of 494.66 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 3-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
|---|---|
| PubChem CID | 24529548 |
| Molecular Formula | C25H22N2O3S3 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]propanoate |
| SMILES | Cc1ccc(-c2csc3ncn(CCC(=O)Oc4ccc(C5SCCS5)cc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C25H22N2O3S3/c1-16-2-4-17(5-3-16)20-14-33-23-22(20)24(29)27(15-26-23)11-10-21(28)30-19-8-6-18(7-9-19)25-31-12-13-32-25/h2-9,14-15,25H,10-13H2,1H3 |
| InChIKey | WFCGPJCMPRTKGZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|