C18H16Cl2FNO3 — CID 24529754
2,4-dichloro-N-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-5-fluorobenzamide (PubChem CID 24529754) has the molecular formula C18H16Cl2FNO3 and a molecular weight of 384.23 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 24529754 |
| Molecular Formula | C18H16Cl2FNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2,4-dichloro-N-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-5-fluorobenzamide |
| SMILES | CCOc1cc2c(cc1NC(=O)c1cc(F)c(Cl)cc1Cl)OC(C)C2 |
| InChI | InChI=1S/C18H16Cl2FNO3/c1-3-24-17-5-10-4-9(2)25-16(10)8-15(17)22-18(23)11-6-14(21)13(20)7-12(11)19/h5-9H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | UUXZZJUGOMHQRM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|