C20H21ClN2O5 — CID 24531285
[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-amino-3-chlorobenzoate (PubChem CID 24531285) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-amino-3-chlorobenzoate.
| Compound Name | [2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 24531285 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-amino-3-chlorobenzoate |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)COC(=O)c1cccc(Cl)c1N)CC2 |
| InChI | InChI=1S/C20H21ClN2O5/c1-26-16-8-12-6-7-23(10-13(12)9-17(16)27-2)18(24)11-28-20(25)14-4-3-5-15(21)19(14)22/h3-5,8-9H,6-7,10-11,22H2,1-2H3 |
| InChIKey | CIWGPHORLCERDR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|