C19H30N4O4S — CID 24533336
2-[4-[4-(dimethylsulfamoyl)benzoyl]piperazin-1-yl]-N,N-diethylacetamide (PubChem CID 24533336) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[4-[4-(dimethylsulfamoyl)benzoyl]piperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-[4-(dimethylsulfamoyl)benzoyl]piperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 24533336 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[4-[4-(dimethylsulfamoyl)benzoyl]piperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)c2ccc(S(=O)(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O4S/c1-5-22(6-2)18(24)15-21-11-13-23(14-12-21)19(25)16-7-9-17(10-8-16)28(26,27)20(3)4/h7-10H,5-6,11-15H2,1-4H3 |
| InChIKey | GXENWUBKNUYXFA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |