C22H21ClN2O4 — CID 24533663
N-[(2S)-1-[4-(2-chlorophenoxy)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 24533663) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is N-[(2S)-1-[4-(2-chlorophenoxy)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-[4-(2-chlorophenoxy)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24533663 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[(2S)-1-[4-(2-chlorophenoxy)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-14(2)20(25-21(26)19-8-5-13-28-19)22(27)24-15-9-11-16(12-10-15)29-18-7-4-3-6-17(18)23/h3-14,20H,1-2H3,(H,24,27)(H,25,26)/t20-/m0/s1 |
| InChIKey | XFGQNPPTODOJKM-FQEVSTJZSA-N |
| XLogP | 5.12 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |