C20H25N3O5S2 — CID 24537150
(2S)-1-(4-methylphenyl)sulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 24537150) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2S)-1-(4-methylphenyl)sulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-methylphenyl)sulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24537150 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (2S)-1-(4-methylphenyl)sulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-15-4-8-18(9-5-15)30(27,28)23-14-2-3-19(23)20(24)22-13-12-16-6-10-17(11-7-16)29(21,25)26/h4-11,19H,2-3,12-14H2,1H3,(H,22,24)(H2,21,25,26)/t19-/m0/s1 |
| InChIKey | BCROLMIJLQELAP-IBGZPJMESA-N |
| XLogP | 1.15 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |