C25H26ClN3O5 — CID 24537804
N-[(2S)-1-[2-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 24537804) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is N-[(2S)-1-[2-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-[2-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24537804 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[(2S)-1-[2-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)NNC(=O)[C@@H](NC(=O)c3ccco3)C(C)C)cc2)ccc1Cl |
| InChI | InChI=1S/C25H26ClN3O5/c1-15(2)22(27-24(31)21-5-4-12-33-21)25(32)29-28-23(30)18-8-6-17(7-9-18)14-34-19-10-11-20(26)16(3)13-19/h4-13,15,22H,14H2,1-3H3,(H,27,31)(H,28,30)(H,29,32)/t22-/m0/s1 |
| InChIKey | CSNVUCFKUYWFEM-QFIPXVFZSA-N |
| XLogP | 4.04 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|