About 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol
2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol (PubChem CID 2453882) has the molecular formula C15H15N3OS
and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol |
| PubChem CID | 2453882 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1ncnc2sccc12 |
| InChI | InChI=1S/C15H15N3OS/c19-8-7-18(10-12-4-2-1-3-5-12)14-13-6-9-20-15(13)17-11-16-14/h1-6,9,11,19H,7-8,10H2 |
| InChIKey | RHQPWRIKACUCNW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol?
The IUPAC name of 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol (CID 2453882) is 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol?
The canonical SMILES for 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol is OCCN(Cc1ccccc1)c1ncnc2sccc12.
What is the InChIKey of 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol?
The InChIKey is RHQPWRIKACUCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3OS/c19-8-7-18(10-12-4-2-1-3-5-12)14-13-6-9-20-15(13)17-11-16-14/h1-6,9,11,19H,7-8,10H2.
What are the key properties of 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol?
2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol has a molecular weight of 285.37 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(thieno[2,3-d]pyrimidin-4-yl)amino]ethanol is sourced from PubChem (CID 2453882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).