C22H25N5O3S — CID 24539242
N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-4-propan-2-yloxybenzohydrazide (PubChem CID 24539242) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-4-propan-2-yloxybenzohydrazide.
| Compound Name | N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 24539242 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-4-propan-2-yloxybenzohydrazide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)NNC(=O)c2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C22H25N5O3S/c1-14(2)30-18-9-7-16(8-10-18)21(29)25-23-19(28)11-12-27-20(24-26-22(27)31)17-6-4-5-15(3)13-17/h4-10,13-14H,11-12H2,1-3H3,(H,23,28)(H,25,29)(H,26,31) |
| InChIKey | UINNWCTXGQIWCC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|