C17H22F2N2O2 — CID 24539671
2,6-difluoro-N-[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide (PubChem CID 24539671) has the molecular formula C17H22F2N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24539671 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2,6-difluoro-N-[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H22F2N2O2/c1-11(2)15(17(23)21-9-4-3-5-10-21)20-16(22)14-12(18)7-6-8-13(14)19/h6-8,11,15H,3-5,9-10H2,1-2H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | UBKQWYZOUZOZGO-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |