C21H27ClN4O5 — CID 24540445
4-(4-chloro-2-methylphenoxy)-N'-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]butanehydrazide (PubChem CID 24540445) has the molecular formula C21H27ClN4O5 and a molecular weight of 450.92 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N'-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]butanehydrazide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N'-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]butanehydrazide |
|---|---|
| PubChem CID | 24540445 |
| Molecular Formula | C21H27ClN4O5 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N'-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]butanehydrazide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NNC(=O)CCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H27ClN4O5/c1-14-13-15(22)6-7-16(14)31-12-4-5-17(27)24-25-18(28)8-11-26-19(29)21(23-20(26)30)9-2-3-10-21/h6-7,13H,2-5,8-12H2,1H3,(H,23,30)(H,24,27)(H,25,28) |
| InChIKey | HZQISJZSHIOTED-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|