C24H20N2O4S — CID 24541454
2-(furan-2-ylmethyl)-5-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)isoindole-1,3-dione (PubChem CID 24541454) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-5-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-(furan-2-ylmethyl)-5-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 24541454 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-(furan-2-ylmethyl)-5-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepine-5-carbonyl)isoindole-1,3-dione |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)c2ccccc2S1 |
| InChI | InChI=1S/C24H20N2O4S/c1-15-10-11-25(20-6-2-3-7-21(20)31-15)22(27)16-8-9-18-19(13-16)24(29)26(23(18)28)14-17-5-4-12-30-17/h2-9,12-13,15H,10-11,14H2,1H3 |
| InChIKey | WQMHICOBIJEVIG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|