C18H18Cl2N2OS — CID 24541570
2-(2,4-dichloro-6-methyl-3-pyridinyl)-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)ethanone (PubChem CID 24541570) has the molecular formula C18H18Cl2N2OS and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methyl-3-pyridinyl)-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)ethanone.
| Compound Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)ethanone |
|---|---|
| PubChem CID | 24541570 |
| Molecular Formula | C18H18Cl2N2OS |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-1-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)ethanone |
| SMILES | Cc1cc(Cl)c(CC(=O)N2CCC(C)Sc3ccccc32)c(Cl)n1 |
| InChI | InChI=1S/C18H18Cl2N2OS/c1-11-9-14(19)13(18(20)21-11)10-17(23)22-8-7-12(2)24-16-6-4-3-5-15(16)22/h3-6,9,12H,7-8,10H2,1-2H3 |
| InChIKey | LFDSITJERDIIOS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|