About 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide
6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide (PubChem CID 24541890) has the molecular formula C21H17N7O3
and a molecular weight of 415.41 g/mol. Its IUPAC name is 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide |
| PubChem CID | 24541890 |
| Molecular Formula | C21H17N7O3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(=O)[nH]c1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H17N7O3/c29-18-11-10-17(12-22-18)21(31)25-24-20(30)16-8-6-14(7-9-16)13-28-26-19(23-27-28)15-4-2-1-3-5-15/h1-12H,13H2,(H,22,29)(H,24,30)(H,25,31) |
| InChIKey | HBCIWGHIYJYWSS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide?
The IUPAC name of 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide (CID 24541890) is 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide.
What is the SMILES notation for 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide?
The canonical SMILES for 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide is O=C(NNC(=O)c1ccc(=O)[nH]c1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1.
What is the InChIKey of 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide?
The InChIKey is HBCIWGHIYJYWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N7O3/c29-18-11-10-17(12-22-18)21(31)25-24-20(30)16-8-6-14(7-9-16)13-28-26-19(23-27-28)15-4-2-1-3-5-15/h1-12H,13H2,(H,22,29)(H,24,30)(H,25,31).
What are the key properties of 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide?
6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide has a molecular weight of 415.41 g/mol, XLogP of 1.15, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-1H-pyridine-3-carbohydrazide is sourced from PubChem (CID 24541890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).