C18H22N4O4 — CID 24542647
4-(cyclopropylamino)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-nitrobenzamide (PubChem CID 24542647) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24542647 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-(cyclopropylamino)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-nitrobenzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C18H22N4O4/c1-21(2)16(17-4-3-9-26-17)11-19-18(23)12-5-8-14(20-13-6-7-13)15(10-12)22(24)25/h3-5,8-10,13,16,20H,6-7,11H2,1-2H3,(H,19,23) |
| InChIKey | SONUIFGABQUIRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|