C21H24N4O2S — CID 24542842
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[2-(tert-butylamino)-2-oxoethyl]benzamide (PubChem CID 24542842) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[2-(tert-butylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[2-(tert-butylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24542842 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[2-(tert-butylamino)-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-21(2,3)25-18(26)12-22-19(27)15-10-8-14(9-11-15)13-28-20-23-16-6-4-5-7-17(16)24-20/h4-11H,12-13H2,1-3H3,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | KHIWWEBSDGPBAA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |