C18H27N3O5S2 — CID 24542893
[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 24542893) has the molecular formula C18H27N3O5S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is [4-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [4-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 24542893 |
| Molecular Formula | C18H27N3O5S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [4-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)N3CCN(S(C)(=O)=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O5S2/c1-15-7-9-21(10-8-15)28(25,26)17-5-3-16(4-6-17)18(22)19-11-13-20(14-12-19)27(2,23)24/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | YJXZXDKITVLFRV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |