C15H22N2O3 — CID 24543011
3-methyl-N'-(2-phenoxybutanoyl)butanehydrazide (PubChem CID 24543011) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-methyl-N'-(2-phenoxybutanoyl)butanehydrazide.
| Compound Name | 3-methyl-N'-(2-phenoxybutanoyl)butanehydrazide |
|---|---|
| PubChem CID | 24543011 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-methyl-N'-(2-phenoxybutanoyl)butanehydrazide |
| SMILES | CCC(Oc1ccccc1)C(=O)NNC(=O)CC(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-4-13(20-12-8-6-5-7-9-12)15(19)17-16-14(18)10-11(2)3/h5-9,11,13H,4,10H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | GAUDJPVVFOUHBC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|