C19H11F5N2O3S — CID 2454440
2,3,4,5-tetrafluoro-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 2454440) has the molecular formula C19H11F5N2O3S and a molecular weight of 442.37 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2454440 |
| Molecular Formula | C19H11F5N2O3S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H11F5N2O3S/c20-10-3-1-9(2-4-10)7-13-18(28)26(19(29)30-13)6-5-25-17(27)11-8-12(21)15(23)16(24)14(11)22/h1-4,7-8H,5-6H2,(H,25,27)/b13-7- |
| InChIKey | AHUDRLFNCKDKCR-QPEQYQDCSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|