C16H17ClN2O3 — CID 24545173
N-[(2S)-1-[(3-chlorophenyl)methyl-methylamino]-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 24545173) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is N-[(2S)-1-[(3-chlorophenyl)methyl-methylamino]-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-[(3-chlorophenyl)methyl-methylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24545173 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[(2S)-1-[(3-chlorophenyl)methyl-methylamino]-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-11(18-15(20)14-7-4-8-22-14)16(21)19(2)10-12-5-3-6-13(17)9-12/h3-9,11H,10H2,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | NLWLHHNHBZPIAR-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |