C25H33N3O4S — CID 24545327
3-methyl-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine-1-carbonyl]-1,5,6,7-tetrahydroindol-4-one (PubChem CID 24545327) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 3-methyl-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine-1-carbonyl]-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-methyl-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine-1-carbonyl]-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 24545327 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 3-methyl-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine-1-carbonyl]-1,5,6,7-tetrahydroindol-4-one |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(C(=O)c3[nH]c4c(c3C)C(=O)CCC4)CC2)c(C)c1C |
| InChI | InChI=1S/C25H33N3O4S/c1-14-15(2)17(4)24(18(5)16(14)3)33(31,32)28-12-10-27(11-13-28)25(30)23-19(6)22-20(26-23)8-7-9-21(22)29/h26H,7-13H2,1-6H3 |
| InChIKey | FDRRYOZKPUBHAI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |