C17H12N4O2S2 — CID 2454688
2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 2454688) has the molecular formula C17H12N4O2S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2454688 |
| Molecular Formula | C17H12N4O2S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C17H12N4O2S2/c22-14-12-8-4-5-9-13(12)15(23)21(14)10-24-17-20-19-16(25-17)18-11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19) |
| InChIKey | TYSLCUFVJVGIDQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|