C20H22ClNO3S — CID 24547309
2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-N-[2-(3-chlorophenyl)ethyl]acetamide (PubChem CID 24547309) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-N-[2-(3-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-N-[2-(3-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 24547309 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-N-[2-(3-chlorophenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)=O)cc1CSCC(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-14(23)16-6-7-19(25-2)17(11-16)12-26-13-20(24)22-9-8-15-4-3-5-18(21)10-15/h3-7,10-11H,8-9,12-13H2,1-2H3,(H,22,24) |
| InChIKey | IFHFUMRJSLQVDW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |