About 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea
1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 2454783) has the molecular formula C16H25N3O3S
and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea.
Molecular Properties
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
| PubChem CID | 2454783 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C16H25N3O3S/c1-20-13-4-5-15(21-2)14(12-13)18-16(23)17-6-3-7-19-8-10-22-11-9-19/h4-5,12H,3,6-11H2,1-2H3,(H2,17,18,23) |
| InChIKey | CJNQRSYYHLQVEF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea?
The IUPAC name of 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea (CID 2454783) is 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea.
What is the SMILES notation for 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea?
The canonical SMILES for 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea is COc1ccc(OC)c(NC(=S)NCCCN2CCOCC2)c1.
What is the InChIKey of 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea?
The InChIKey is CJNQRSYYHLQVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O3S/c1-20-13-4-5-15(21-2)14(12-13)18-16(23)17-6-3-7-19-8-10-22-11-9-19/h4-5,12H,3,6-11H2,1-2H3,(H2,17,18,23).
What are the key properties of 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea?
1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea has a molecular weight of 339.46 g/mol, XLogP of 1.71, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea is sourced from PubChem (CID 2454783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).