C26H20FN5OS — CID 24548750
N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 24548750) has the molecular formula C26H20FN5OS and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 24548750 |
| Molecular Formula | C26H20FN5OS |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)c1c[nH]c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20FN5OS/c27-20-11-13-22(14-12-20)32-23(16-29-26(32)34)25(33)28-15-19-17-31(21-9-5-2-6-10-21)30-24(19)18-7-3-1-4-8-18/h1-14,16-17H,15H2,(H,28,33)(H,29,34) |
| InChIKey | VPCWADIGSQQISM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|