C16H17NOS — CID 2454977
(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-methylphenyl)methanone (PubChem CID 2454977) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-methylphenyl)methanone.
| Compound Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 2454977 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)c2c(N)sc3c2CCCC3)c1 |
| InChI | InChI=1S/C16H17NOS/c1-10-5-4-6-11(9-10)15(18)14-12-7-2-3-8-13(12)19-16(14)17/h4-6,9H,2-3,7-8,17H2,1H3 |
| InChIKey | ZPRLDCBLJUFUMQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|