C21H27FN2O4S — CID 24550136
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(4-propan-2-ylphenyl)sulfonylamino]propanamide (PubChem CID 24550136) has the molecular formula C21H27FN2O4S and a molecular weight of 422.52 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(4-propan-2-ylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(4-propan-2-ylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 24550136 |
| Molecular Formula | C21H27FN2O4S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-[(4-propan-2-ylphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(C(C)NC(=O)CCNS(=O)(=O)c2ccc(C(C)C)cc2)cc1F |
| InChI | InChI=1S/C21H27FN2O4S/c1-14(2)16-5-8-18(9-6-16)29(26,27)23-12-11-21(25)24-15(3)17-7-10-20(28-4)19(22)13-17/h5-10,13-15,23H,11-12H2,1-4H3,(H,24,25) |
| InChIKey | SJHXJVOMRDCNRY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |