C15H19ClN2O4 — CID 2455107
(2-amino-2-oxoethyl) (2R,3R)-2-[(4-chlorobenzoyl)amino]-3-methylpentanoate (PubChem CID 2455107) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2R,3R)-2-[(4-chlorobenzoyl)amino]-3-methylpentanoate.
| Compound Name | (2-amino-2-oxoethyl) (2R,3R)-2-[(4-chlorobenzoyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 2455107 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (2-amino-2-oxoethyl) (2R,3R)-2-[(4-chlorobenzoyl)amino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)OCC(N)=O |
| InChI | InChI=1S/C15H19ClN2O4/c1-3-9(2)13(15(21)22-8-12(17)19)18-14(20)10-4-6-11(16)7-5-10/h4-7,9,13H,3,8H2,1-2H3,(H2,17,19)(H,18,20)/t9-,13-/m1/s1 |
| InChIKey | JGGPRYOPSJKDNW-NOZJJQNGSA-N |
| XLogP | 1.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |