C22H32N4O3 — CID 24551077
N-[[2-(diethylaminomethyl)phenyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide (PubChem CID 24551077) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[[2-(diethylaminomethyl)phenyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide.
| Compound Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 24551077 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)CCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C22H32N4O3/c1-3-25(4-2)16-18-10-6-5-9-17(18)15-23-19(27)11-14-26-20(28)22(24-21(26)29)12-7-8-13-22/h5-6,9-10H,3-4,7-8,11-16H2,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | URPOIMNSZJCIEM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|