C22H28N4O5 — CID 24551460
N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-4-(2-methoxyethylamino)-N-methyl-3-nitrobenzamide (PubChem CID 24551460) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-4-(2-methoxyethylamino)-N-methyl-3-nitrobenzamide.
| Compound Name | N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-4-(2-methoxyethylamino)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 24551460 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-4-(2-methoxyethylamino)-N-methyl-3-nitrobenzamide |
| SMILES | CCN1CC(CN(C)C(=O)c2ccc(NCCOC)c([N+](=O)[O-])c2)Oc2ccccc21 |
| InChI | InChI=1S/C22H28N4O5/c1-4-25-15-17(31-21-8-6-5-7-19(21)25)14-24(2)22(27)16-9-10-18(23-11-12-30-3)20(13-16)26(28)29/h5-10,13,17,23H,4,11-12,14-15H2,1-3H3 |
| InChIKey | RGKIVPASQXQXPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|