About 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide
2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide (PubChem CID 24551481) has the molecular formula C19H20BrFN2O2
and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide |
| PubChem CID | 24551481 |
| Molecular Formula | C19H20BrFN2O2 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide |
| SMILES | CCN1CC(CN(C)C(=O)c2cc(F)ccc2Br)Oc2ccccc21 |
| InChI | InChI=1S/C19H20BrFN2O2/c1-3-23-12-14(25-18-7-5-4-6-17(18)23)11-22(2)19(24)15-10-13(21)8-9-16(15)20/h4-10,14H,3,11-12H2,1-2H3 |
| InChIKey | DAMIKTTWJUVSNM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide?
The IUPAC name of 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide (CID 24551481) is 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide.
What is the SMILES notation for 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide?
The canonical SMILES for 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide is CCN1CC(CN(C)C(=O)c2cc(F)ccc2Br)Oc2ccccc21.
What is the InChIKey of 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide?
The InChIKey is DAMIKTTWJUVSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrFN2O2/c1-3-23-12-14(25-18-7-5-4-6-17(18)23)11-22(2)19(24)15-10-13(21)8-9-16(15)20/h4-10,14H,3,11-12H2,1-2H3.
What are the key properties of 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide?
2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide has a molecular weight of 407.28 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methyl]-5-fluoro-N-methylbenzamide is sourced from PubChem (CID 24551481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).