C11H15ClFN2O2+ — CID 2455215
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-[(2R)-2-hydroxypropyl]azanium (PubChem CID 2455215) has the molecular formula C11H15ClFN2O2+ and a molecular weight of 261.70 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-[(2R)-2-hydroxypropyl]azanium.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-[(2R)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2455215 |
| Molecular Formula | C11H15ClFN2O2+ |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-[(2R)-2-hydroxypropyl]azanium |
| SMILES | C[C@@H](O)C[NH2+]CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H14ClFN2O2/c1-7(16)5-14-6-11(17)15-10-3-2-8(12)4-9(10)13/h2-4,7,14,16H,5-6H2,1H3,(H,15,17)/p+1/t7-/m1/s1 |
| InChIKey | LTAKHORQJRDBMC-SSDOTTSWSA-O |
| XLogP | 0.36 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |