C23H22ClFN2O4S — CID 24552174
3-(benzylsulfamoyl)-4-chloro-N-[2-(2-fluorophenoxy)ethyl]-N-methylbenzamide (PubChem CID 24552174) has the molecular formula C23H22ClFN2O4S and a molecular weight of 476.96 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-4-chloro-N-[2-(2-fluorophenoxy)ethyl]-N-methylbenzamide.
| Compound Name | 3-(benzylsulfamoyl)-4-chloro-N-[2-(2-fluorophenoxy)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 24552174 |
| Molecular Formula | C23H22ClFN2O4S |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 3-(benzylsulfamoyl)-4-chloro-N-[2-(2-fluorophenoxy)ethyl]-N-methylbenzamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22ClFN2O4S/c1-27(13-14-31-21-10-6-5-9-20(21)25)23(28)18-11-12-19(24)22(15-18)32(29,30)26-16-17-7-3-2-4-8-17/h2-12,15,26H,13-14,16H2,1H3 |
| InChIKey | QUQPPFOGAGKTRG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |