C20H21ClN4O2 — CID 24552430
1-(4-chlorophenyl)-5-methyl-N-(4-phenoxybutyl)-1,2,4-triazole-3-carboxamide (PubChem CID 24552430) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-N-(4-phenoxybutyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-N-(4-phenoxybutyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 24552430 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-N-(4-phenoxybutyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCCOc2ccccc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN4O2/c1-15-23-19(24-25(15)17-11-9-16(21)10-12-17)20(26)22-13-5-6-14-27-18-7-3-2-4-8-18/h2-4,7-12H,5-6,13-14H2,1H3,(H,22,26) |
| InChIKey | GMOFDSDQLUELFF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|