C17H22N2O3S2 — CID 24552645
N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 24552645) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 24552645 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)N(C)C(C)c2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-13-7-9-15(10-8-13)24(21,22)18(3)12-17(20)19(4)14(2)16-6-5-11-23-16/h5-11,14H,12H2,1-4H3 |
| InChIKey | OOSDLORKNZVQDM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |