C29H29N3O3S — CID 24553080
2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]acetamide (PubChem CID 24553080) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 24553080 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCc3ccccc32)C1=O)NC(c1ccc2c(c1)CCCC2)c1cccs1 |
| InChI | InChI=1S/C29H29N3O3S/c33-25(18-32-27(34)29(31-28(32)35)15-5-10-20-8-3-4-11-23(20)29)30-26(24-12-6-16-36-24)22-14-13-19-7-1-2-9-21(19)17-22/h3-4,6,8,11-14,16-17,26H,1-2,5,7,9-10,15,18H2,(H,30,33)(H,31,35) |
| InChIKey | LMLBNQFOYNXPMI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|