C19H20ClN7O3S — CID 24553616
N'-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 24553616) has the molecular formula C19H20ClN7O3S and a molecular weight of 461.94 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24553616 |
| Molecular Formula | C19H20ClN7O3S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N'-[1-(4-chlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1nc(C)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H20ClN7O3S/c1-11-15(31-19(21-11)26-7-9-30-10-8-26)17(28)23-24-18(29)16-22-12(2)27(25-16)14-5-3-13(20)4-6-14/h3-6H,7-10H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | MRAAVLIXEHNFAA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|