C25H27FN2O4S — CID 24554638
3-[(4-fluorophenyl)methoxy]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide (PubChem CID 24554638) has the molecular formula C25H27FN2O4S and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methoxy]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-[(4-fluorophenyl)methoxy]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24554638 |
| Molecular Formula | C25H27FN2O4S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 3-[(4-fluorophenyl)methoxy]-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)c1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H27FN2O4S/c1-18(2)28-33(30,31)17-22-7-4-3-6-21(22)15-27-25(29)20-8-5-9-24(14-20)32-16-19-10-12-23(26)13-11-19/h3-14,18,28H,15-17H2,1-2H3,(H,27,29) |
| InChIKey | MZRXCTKKYRIVJO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |