C23H31N3O3S — CID 24555453
3-[4-(dimethylamino)phenyl]-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]propanamide (PubChem CID 24555453) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 24555453 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]propanamide |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(NC(=O)CCc3ccc(N(C)C)cc3)cc2)C1 |
| InChI | InChI=1S/C23H31N3O3S/c1-18-5-4-16-26(17-18)30(28,29)22-13-9-20(10-14-22)24-23(27)15-8-19-6-11-21(12-7-19)25(2)3/h6-7,9-14,18H,4-5,8,15-17H2,1-3H3,(H,24,27) |
| InChIKey | SUUPCSKZUXXTNE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|