About (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate
(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate (PubChem CID 24555799) has the molecular formula C21H22FNO3
and a molecular weight of 355.41 g/mol. Its IUPAC name is (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate.
Molecular Properties
| Compound Name | (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate |
| PubChem CID | 24555799 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate |
| SMILES | CC1CC(=O)c2c(OC(=O)CCc3ccc(N(C)C)cc3)ccc(F)c21 |
| InChI | InChI=1S/C21H22FNO3/c1-13-12-17(24)21-18(10-9-16(22)20(13)21)26-19(25)11-6-14-4-7-15(8-5-14)23(2)3/h4-5,7-10,13H,6,11-12H2,1-3H3 |
| InChIKey | VLLCJSBOOKAJTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate?
The IUPAC name of (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate (CID 24555799) is (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate.
What is the SMILES notation for (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate?
The canonical SMILES for (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate is CC1CC(=O)c2c(OC(=O)CCc3ccc(N(C)C)cc3)ccc(F)c21.
What is the InChIKey of (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate?
The InChIKey is VLLCJSBOOKAJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FNO3/c1-13-12-17(24)21-18(10-9-16(22)20(13)21)26-19(25)11-6-14-4-7-15(8-5-14)23(2)3/h4-5,7-10,13H,6,11-12H2,1-3H3.
What are the key properties of (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate?
(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate has a molecular weight of 355.41 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl) 3-[4-(dimethylamino)phenyl]propanoate is sourced from PubChem (CID 24555799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).