C23H29N3O3S — CID 24555857
2,3,4,5,6-pentamethyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 24555857) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 24555857 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N(Cc2nnc(-c3ccccc3)o2)C(C)C)c(C)c1C |
| InChI | InChI=1S/C23H29N3O3S/c1-14(2)26(13-21-24-25-23(29-21)20-11-9-8-10-12-20)30(27,28)22-18(6)16(4)15(3)17(5)19(22)7/h8-12,14H,13H2,1-7H3 |
| InChIKey | NKEJATQAHACJPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |