About 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one
6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 2455800) has the molecular formula C18H14N2O3S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 2455800 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cccc(-c2nc(-c3ccc4c(c3)NC(=O)CO4)cs2)c1 |
| InChI | InChI=1S/C18H14N2O3S/c1-22-13-4-2-3-12(7-13)18-20-15(10-24-18)11-5-6-16-14(8-11)19-17(21)9-23-16/h2-8,10H,9H2,1H3,(H,19,21) |
| InChIKey | FDQMWWWTILFTKR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (CID 2455800) is 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one is COc1cccc(-c2nc(-c3ccc4c(c3)NC(=O)CO4)cs2)c1.
What is the InChIKey of 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one?
The InChIKey is FDQMWWWTILFTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3S/c1-22-13-4-2-3-12(7-13)18-20-15(10-24-18)11-5-6-16-14(8-11)19-17(21)9-23-16/h2-8,10H,9H2,1H3,(H,19,21).
What are the key properties of 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one?
6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one has a molecular weight of 338.39 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 2455800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).